Chemistry

Chemistry in Everyday Life

Question:

Synthetic detergents have advantage over usual soaps as far as cleansing power is concerned. But use of synthetic detergents over a long time creates environmental pollution. How can the pollution caused by synthetic detergents be minimized? Classify the detergents according to their chemical nature.

Answer:

Synthetic detergents are cleansing agents which have all the properties of soaps, but which actually do not contain any soap. These can be used both in soft and hard water as they given foam even in hard water. Detergents can be classified into three groups according their chemical nature.
(i) Anionic detergents – These are sodium salts of sulphonated long chain alcohols or hydrocarbons and sodium alkyl benzene sulphonates. e.g., CH3(CH2)10CH2OSO3–  Na+
Anionic part of these detergents is involved in cleansing action.
(ii) Cationic detergents – These are quaternary ammonium salts of amines with acetates, chlorides or bromides as anions.
ncert-exemplar-problems-class-12-chemistry-chemistry-everyday-life-21
(iii) Non-ionic detergents – These do not contain any ion in their constitution, e.g., detergent formed by steric acid and polyethylene glycol. CH3(CH2)16C00(CH2CH20)nCH2CH2OH.
Pollution by synthetic detergents can be minimized by reducing the branching of hydrocarbon chain or using unbranched hydrocarbons.

previuos
next

Chemistry in Everyday Life

Q 1.

What is a soft soap?

Q 2.

Explain the term, target molecules or drug targets as used in medicinal chemistry.

Q 3.

What is meant by the term broad spectrum antibiotics? Explain.

Q 4.

Compounds with antiseptic properties are
(a) CHCl,   (b) CHI3
(c) Boric acid   (d) 0.3 ppm aqueous solution of Cl2

Q 5.

What are antiseptics?

Q 6.

Assertion (A): Chemical messengers are chemicals that enable communi ¬cation of message between two neutrons or between neurons and muscles. Reason (R): Chemicals enter the cell through receptor.

Q 7.

What are antagonistic drugs?

Q 8.

With the help of an example explain how do tranquilizers control the feeling of depression?

Q 9.

Sodium salts of some acids are Very useful as food preservatives. Suggest a few such acids.

Q 10.

What are the functions performed by histamine in the body?

Q 11.

Write the chemical equation for preparing sodium soap from glyceryl oleate and glyceryl palmitate. Structures of these compounds are given below:
(i)(C15H31COO)3C3H5-Glyceryl palmitate
(ii)(C17H32COO)3C3H5-Glyceryl oleate

Q 12.

Which of the following compounds are administered as ant-acids?
(a) Sodium carbonate (b)Sodium Hydrogen carbonate
(c)Aluminium carbonate (d)Magnism Hydroxide

Q 13.

How does the branching of hydrocarbon chain of synthetic detergents affect their biodegradability?

Q 14.

Which type of drugs come under antimicrobial drugs?

Q 15.

How are transparent soaps manufactured?

Q 16.

What happens when the bond formed between an enzyme and an inhibitor is a strong covalent bond?

Q 17.

Name the macro molecules that are chosen as drug targets.

Q 18.

Hair shampoos belong to which class of synthetic detergent?

Q 19.

Which of the following are anionic detergents?
(a) Sodium salts of sulphonated long chain alcohol.
(b) Ester of stearic acid and polyethylene glycol.
(c) Quaternary ammonium salt of amine with acetate ion.
(d) Sodium salts of sulphonated long chain hydrocarbons.

Q 20.

Aspirin is pain relieving antipyretic drug but can be used to prevent heart attack. Explain.

Q 21.

Name two ct-amino acids which form a dipeptide which is 100 times more sweet than cane sugar?

Q 22.

Match the class of compounds given in Column I with their functions given in Column II.
ncert-exemplar-problems-class-12-chemistry-chemistry-everyday-life-15
ncert-exemplar-problems-class-12-chemistry-chemistry-everyday-life-16

Q 23.

Assertion (A): Receptors are crucial to body's communication process. Reason (R): Receptors are proteins.

Q 24.

Why do we need to classify drugs in different ways?

Q 25.

Name the sweetening agent used in the preparation of sweets for a diabetic patient.

Q 26.

Write the uses of medicines.

Q 27.

What is the scientific explanation for the feeling of depression?

Q 28.

What is the mode of action of antimicrobial drugs?

Q 29.

Why are certain drugs called enzyme inhibitors?

Q 30.

Assertion (A): Competitive inhibitors compete with natural substrate for their attachment on the active sites of enzymes.
Reason (R): In competitive inhibition, inhibitor binds to the allosteric site of the enzyme.

Q 31.

Assertion (A): All chemicals added to food items are called food preservatives.
Reason (R): All these chemicals increase the nutritive value of the food.

Q 32.

Assertion (A): Artificial sweeteners are added to the food to control the intake of calories.
Reason (R): Most of the artificial sweeteners are inert and do not metabolise in the body.

Q 33.

Synthetic detergents have advantage over usual soaps as far as cleansing power is concerned. But use of synthetic detergents over a long time creates environmental pollution. How can the pollution caused by synthetic detergents be minimized? Classify the detergents according to their chemical nature.

Q 34.

What are enzyme inhibitors? Classify them on the basis of their mode of attachments on the active site of enzymes. With the help of diagrams explain how do inhibitors inhibit the enzymatic activity.
Ckemistnj in Evenjdai] Life 325

Q 35.

Why do we require artificial sweetening agents?

Q 36.

Low level of noradrenaline is the cause of depression. What type of drugs are needed to cure this problem? Name two drugs.

Q 37.

How do antiseptics differ from disinfectants? Give one example of each.

Q 38.

What problem arises in using alitame as artificial sweetener?

Q 39.

What are biodegradable and non-biodegradable detergents? Give one example of each.

Q 40.

Why do soaps not work in hard water?

Q 41.

Can you use soaps and synthetic detergents to check the hardness of water?

Q 42.

Explain the cleansing action of soaps.

Q 43.

Which of the following statements are incorrect about receptor proteins?
(a) Majority of receptor proteins are embedded in the cell membranes.
(b) The active site of receptor proteins opens on the inside region of the cell.
(c) Chemical messengers are received at the binding sites of receptor proteins.
(d) Shape of receptor does not change during attachment of messenger.

Q 44.

Which of the following are sulpha drugs?
(a) Sulphapyridine (b) Prontosil
(c) Salvarsan (d) Nardil

Q 45.

Veronal and Luminal are derivatives of barbituric acid which are ………….

Q 46.

Which class of drugs is used in sleeping pills?

Q 47.

What is the medicinal use of narcotic drugs?

Q 48.

What is the advantage of using antihistamines over antacids in the treatment of acidity?

Q 49.

What are fillers and what role these fillers play in soap?

Q 50.

Pickles have a long shelf life and do not get spoiled for months, why?