Chemistry

Chemistry in Everyday Life

Question:

Synthetic detergents have advantage over usual soaps as far as cleansing power is concerned. But use of synthetic detergents over a long time creates environmental pollution. How can the pollution caused by synthetic detergents be minimized? Classify the detergents according to their chemical nature.

Answer:

Synthetic detergents are cleansing agents which have all the properties of soaps, but which actually do not contain any soap. These can be used both in soft and hard water as they given foam even in hard water. Detergents can be classified into three groups according their chemical nature.
(i) Anionic detergents – These are sodium salts of sulphonated long chain alcohols or hydrocarbons and sodium alkyl benzene sulphonates. e.g., CH3(CH2)10CH2OSO3–  Na+
Anionic part of these detergents is involved in cleansing action.
(ii) Cationic detergents – These are quaternary ammonium salts of amines with acetates, chlorides or bromides as anions.
ncert-exemplar-problems-class-12-chemistry-chemistry-everyday-life-21
(iii) Non-ionic detergents – These do not contain any ion in their constitution, e.g., detergent formed by steric acid and polyethylene glycol. CH3(CH2)16C00(CH2CH20)nCH2CH2OH.
Pollution by synthetic detergents can be minimized by reducing the branching of hydrocarbon chain or using unbranched hydrocarbons.

previuos
next

Chemistry in Everyday Life

Q 1.

How are transparent soaps manufactured?

Q 2.

Why do we need to classify drugs in different ways?

Q 3.

Veronal and Luminal are derivatives of barbituric acid which are ………….

Q 4.

What is the basic difference between antiseptics and disinfectants?

Q 5.

What are antiseptics?

Q 6.

What is the medicinal use of narcotic drugs?

Q 7.

How do antiseptics differ from disinfectants? Give one example of each.

Q 8.

What is a soft soap?

Q 9.

Assertion (A): Transparent soaps are made by dissolving soaps in ethanol. Reason (R): Ethanol makes things invisible.

Q 10.

What are the functions performed by histamine in the body?

Q 11.

With refrence to which classification has the statement "ranitidine is an antacid", been given?

Q 12.

Match the medicines given in Column I with their use given in Column II.
ncert-exemplar-problems-class-12-chemistry-chemistry-everyday-life-8

Q 13.

Assertion (A): Preservative are added to food items.
Reason (R): Preservatives inhibit the growth of microorganisms.

Q 14.

Compounds with antiseptic properties are
(a) CHCl,   (b) CHI3
(c) Boric acid   (d) 0.3 ppm aqueous solution of Cl2

Q 15.

What is the harmful effect of hyperacidity?

Q 16.

Assertion (A): Receptor proteins show selectivity for one chemical messenger over the other.
Reason (R): Chemical messenger binds to the receptor site and inhibits its natural function.

Q 17.

While antacids and antiallergic drugs interfere with the function of histamines, why do these not interfere with the function of each other?

Q 18.

What is meant by the term broad spectrum antibiotics? Explain.

Q 19.

Why are cimetidine and ranitidine better antacids than sodium hydrogencarbonate or magnesium or aluminium hydroxide?

Q 20.

What are biodegradable and non-biodegradable detergents? Give one example of each.

Q 21.

Which of the following are not used as food preservatives?
(a) Table salt (b) Sodium hydrogen carbonate
(c) Cane sugar (d) Benzoic acid

Q 22.

Which class of drugs is used in sleeping pills?

Q 23.

What is the scientific explanation for the feeling of depression?

Q 24.

Define the term chemotherapy.

Q 25.

Which type of drugs come under antimicrobial drugs?

Q 26.

How does the branching of hydrocarbon chain of synthetic detergents affect their biodegradability?

Q 27.

Why are certain drugs called enzyme inhibitors?

Q 28.

Match the class of compounds given in Column I with their functions given in Column II.
ncert-exemplar-problems-class-12-chemistry-chemistry-everyday-life-15
ncert-exemplar-problems-class-12-chemistry-chemistry-everyday-life-16

Q 29.

In what respect do prontosil and Salvarsan resemble? Is there any resemblance between azo dye and prontosil? Explain.

Q 30.

What are enzyme inhibitors? Classify them on the basis of their mode of attachments on the active site of enzymes. With the help of diagrams explain how do inhibitors inhibit the enzymatic activity.
Ckemistnj in Evenjdai] Life 325

Q 31.

Explain the cleansing action of soaps.

Q 32.

Which of the following compounds are administered as ant-acids?
(a) Sodium carbonate (b)Sodium Hydrogen carbonate
(c)Aluminium carbonate (d)Magnism Hydroxide

Q 33.

Write the uses of medicines.

Q 34.

Hair shampoos belong to which class of synthetic detergent?

Q 35.

Name two ct-amino acids which form a dipeptide which is 100 times more sweet than cane sugar?

Q 36.

How are receptor proteins located in the cell membrane?

Q 37.

What happens when the bond formed between an enzyme and an inhibitor is a strong covalent bond?

Q 38.

Match the soaps given in Column I with items given in Column II.
ncert-exemplar-problems-class-12-chemistry-chemistry-everyday-life-10

Q 39.

Assertion (A): Competitive inhibitors compete with natural substrate for their attachment on the active sites of enzymes.
Reason (R): In competitive inhibition, inhibitor binds to the allosteric site of the enzyme.

Q 40.

Assertion (A): Non-competitive inhibitor inhibits the catalytic activity of enzyme by binding with its active site.
Reason (R): Non-competitive inhibitors changes the shape of the active site in such a way that substrate cannot recognize it.

Q 41.

Assertion (A): Artificial sweeteners are added to the food to control the intake of calories.
Reason (R): Most of the artificial sweeteners are inert and do not metabolise in the body.

Q 42.

Sleeping pills are recommended by doctors to the patients suffering from sleeplessness but it is not advisable to take its doses without consultation with the doctor. Why?

Q 43.

Name the macro molecules that are chosen as drug targets.

Q 44.

Why should not medicines be taken without consulting doctors?

Q 45.

Low level of noradrenaline is the cause of depression. What type of drugs are needed to cure this problem? Name two drugs.

Q 46.

What are food preservatives?

Q 47.

Why is the use of aspartame limited to cold foods and drinks?

Q 48.

Why do soaps not work in hard water?

Q 49.

Which of the following is an example of liquid dishwashing detergent?
ncert-exemplar-problems-class-12-chemistry-chemistry-everyday-life-1

Q 50.

Which of the following statements are incorrect about receptor proteins?
(a) Majority of receptor proteins are embedded in the cell membranes.
(b) The active site of receptor proteins opens on the inside region of the cell.
(c) Chemical messengers are received at the binding sites of receptor proteins.
(d) Shape of receptor does not change during attachment of messenger.