Chemistry

Chemistry in Everyday Life

Question:

Synthetic detergents have advantage over usual soaps as far as cleansing power is concerned. But use of synthetic detergents over a long time creates environmental pollution. How can the pollution caused by synthetic detergents be minimized? Classify the detergents according to their chemical nature.

Answer:

Synthetic detergents are cleansing agents which have all the properties of soaps, but which actually do not contain any soap. These can be used both in soft and hard water as they given foam even in hard water. Detergents can be classified into three groups according their chemical nature.
(i) Anionic detergents – These are sodium salts of sulphonated long chain alcohols or hydrocarbons and sodium alkyl benzene sulphonates. e.g., CH3(CH2)10CH2OSO3–  Na+
Anionic part of these detergents is involved in cleansing action.
(ii) Cationic detergents – These are quaternary ammonium salts of amines with acetates, chlorides or bromides as anions.
ncert-exemplar-problems-class-12-chemistry-chemistry-everyday-life-21
(iii) Non-ionic detergents – These do not contain any ion in their constitution, e.g., detergent formed by steric acid and polyethylene glycol. CH3(CH2)16C00(CH2CH20)nCH2CH2OH.
Pollution by synthetic detergents can be minimized by reducing the branching of hydrocarbon chain or using unbranched hydrocarbons.

previuos
next

Chemistry in Everyday Life

Q 1.

Assertion (A): Receptor proteins show selectivity for one chemical messenger over the other.
Reason (R): Chemical messenger binds to the receptor site and inhibits its natural function.

Q 2.

Between sodium hydrogen carbonate and magnesium hydroxide which is a better antacid and why?

Q 3.

What is the scientific explanation for the feeling of depression?

Q 4.

Why are certain drugs called enzyme inhibitors?

Q 5.

While antacids and antiallergic drugs interfere with the function of histamines, why do these not interfere with the function of each other?

Q 6.

Which site of an enzyme is called allosteric site?

Q 7.

What is the medicinal use of narcotic drugs?

Q 8.

Assertion (A): Artificial sweeteners are added to the food to control the intake of calories.
Reason (R): Most of the artificial sweeteners are inert and do not metabolise in the body.

Q 9.

Aspirin is pain relieving antipyretic drug but can be used to prevent heart attack. Explain.

Q 10.

What is the medicinal use of narcotic drugs?

Q 11.

Which of the following are sulpha drugs?
(a) Sulphapyridine (b) Prontosil
(c) Salvarsan (d) Nardil

Q 12.

Which of the following are antidepressants?
(a) Iproniazid (b) Phenelzine (c) Equanil (d) Salvarsan

Q 13.

Assertion (A): Chemical messenger gives message to the cell without entering the cell.
Reason (R): Chemical messenger is received at the binding site of receptor proteins.

Q 14.

What is the basic difference between antiseptics and disinfectants?

Q 15.

What is the advantage of using antihistamines over antacids in the treatment of acidity?

Q 16.

Pickles have a long shelf life and do not get spoiled for months, why?

Q 17.

Sodium salts of some acids are Very useful as food preservatives. Suggest a few such acids.

Q 18.

What happens when the bond formed between an enzyme and an inhibitor is a strong covalent bond?

Q 19.

What are enzyme inhibitors? Classify them on the basis of their mode of attachments on the active site of enzymes. With the help of diagrams explain how do inhibitors inhibit the enzymatic activity.
Ckemistnj in Evenjdai] Life 325

Q 20.

With refrence to which classification has the statement "ranitidine is an antacid", been given?

Q 21.

What is meant by the term broad spectrum antibiotics? Explain.

Q 22.

Why is the use of aspartame limited to cold foods and drinks?

Q 23.

What are artificial sweetening agents? Give two examples.

Q 24.

What problem arises in using alitame as artificial sweetener?

Q 25.

What is a soft soap?

Q 26.

What is the mode of action of antimicrobial drugs?

Q 27.

What are the functions performed by histamine in the body?

Q 28.

Name an artificial sweetener which is derivative of sucrose.

Q 29.

Assertion (A): Competitive inhibitors compete with natural substrate for their attachment on the active sites of enzymes.
Reason (R): In competitive inhibition, inhibitor binds to the allosteric site of the enzyme.

Q 30.

Assertion (A): All chemicals added to food items are called food preservatives.
Reason (R): All these chemicals increase the nutritive value of the food.

Q 31.

Name a substance which can be used as an antiseptic as well as disinfectant.

Q 32.

What are the main constituents of dettol?

Q 33.

What is tincture of iodine? What is its use?

Q 34.

Which of the following statements are incorrect about receptor proteins?
(a) Majority of receptor proteins are embedded in the cell membranes.
(b) The active site of receptor proteins opens on the inside region of the cell.
(c) Chemical messengers are received at the binding sites of receptor proteins.
(d) Shape of receptor does not change during attachment of messenger.

Q 35.

Which of the following statements are correct about barbiturates?
(a) Hypnotics or sleep producing agents.
(b) These are tranquilizers.
(c) Non-narcotic analgesics.
(d) Pain reducing without disturbing the nervous system.

Q 36.

What are antagonistic drugs?

Q 37.

Name two ct-amino acids which form a dipeptide which is 100 times more sweet than cane sugar?

Q 38.

How are receptor proteins located in the cell membrane?

Q 39.

Assertion (A): Sulpha drug contain sulphonamide group.
Reason (R): Salvarsan is a sulpha drug.

Q 40.

Assertion (A): Preservative are added to food items.
Reason (R): Preservatives inhibit the growth of microorganisms.

Q 41.

With refrence to which classification has the statement "ranitidine is an antacid", been given?

Q 42.

Why do we require artificial sweetening agents?

Q 43.

Name the macro molecules that are chosen as drug targets.

Q 44.

Why should not medicines be taken without consulting doctors?

Q 45.

How do antiseptics differ from disinfectants? Give one example of each.

Q 46.

How are synthetic detergents better than soaps?

Q 47.

Compounds with antiseptic properties are
(a) CHCl,   (b) CHI3
(c) Boric acid   (d) 0.3 ppm aqueous solution of Cl2

Q 48.

Veronal and Luminal are derivatives of barbituric acid which are ………….

Q 49.

What are antiseptics?

Q 50.

Where are receptors located?