Chemistry

Chemistry in Everyday Life

Question:

Synthetic detergents have advantage over usual soaps as far as cleansing power is concerned. But use of synthetic detergents over a long time creates environmental pollution. How can the pollution caused by synthetic detergents be minimized? Classify the detergents according to their chemical nature.

Answer:

Synthetic detergents are cleansing agents which have all the properties of soaps, but which actually do not contain any soap. These can be used both in soft and hard water as they given foam even in hard water. Detergents can be classified into three groups according their chemical nature.
(i) Anionic detergents – These are sodium salts of sulphonated long chain alcohols or hydrocarbons and sodium alkyl benzene sulphonates. e.g., CH3(CH2)10CH2OSO3–  Na+
Anionic part of these detergents is involved in cleansing action.
(ii) Cationic detergents – These are quaternary ammonium salts of amines with acetates, chlorides or bromides as anions.
ncert-exemplar-problems-class-12-chemistry-chemistry-everyday-life-21
(iii) Non-ionic detergents – These do not contain any ion in their constitution, e.g., detergent formed by steric acid and polyethylene glycol. CH3(CH2)16C00(CH2CH20)nCH2CH2OH.
Pollution by synthetic detergents can be minimized by reducing the branching of hydrocarbon chain or using unbranched hydrocarbons.

previuos
next

Chemistry in Everyday Life

Q 1.

How are transparent soaps manufactured?

Q 2.

Why do we need to classify drugs in different ways?

Q 3.

What are antiseptics?

Q 4.

Compounds with antiseptic properties are
(a) CHCl,   (b) CHI3
(c) Boric acid   (d) 0.3 ppm aqueous solution of Cl2

Q 5.

What is the basic difference between antiseptics and disinfectants?

Q 6.

What is a soft soap?

Q 7.

How do antiseptics differ from disinfectants? Give one example of each.

Q 8.

Assertion (A): Chemical messengers are chemicals that enable communi ¬cation of message between two neutrons or between neurons and muscles. Reason (R): Chemicals enter the cell through receptor.

Q 9.

Why is it safer to use soap from the environmental point of view?

Q 10.

Sodium salts of some acids are Very useful as food preservatives. Suggest a few such acids.

Q 11.

What happens when the bond formed between an enzyme and an inhibitor is a strong covalent bond?

Q 12.

Explain the term, target molecules or drug targets as used in medicinal chemistry.

Q 13.

Which of the following are not used as food preservatives?
(a) Table salt (b) Sodium hydrogen carbonate
(c) Cane sugar (d) Benzoic acid

Q 14.

How does the branching of hydrocarbon chain of synthetic detergents affect their biodegradability?

Q 15.

Assertion (A): Preservative are added to food items.
Reason (R): Preservatives inhibit the growth of microorganisms.

Q 16.

Veronal and Luminal are derivatives of barbituric acid which are ………….

Q 17.

What are fillers and what role these fillers play in soap?

Q 18.

What is meant by the term broad spectrum antibiotics? Explain.

Q 19.

Why are cimetidine and ranitidine better antacids than sodium hydrogencarbonate or magnesium or aluminium hydroxide?

Q 20.

What is the advantage of using antihistamines over antacids in the treatment of acidity?

Q 21.

What are the functions performed by histamine in the body?

Q 22.

Name two ct-amino acids which form a dipeptide which is 100 times more sweet than cane sugar?

Q 23.

Assertion (A): Sodium chloride is added to precipitate soap after saponification.
Reason (R): Hydrolysis of esters of long chain fatty acids by alkali produces soap in colloidal form.

Q 24.

Assertion (A): Artificial sweeteners are added to the food to control the intake of calories.
Reason (R): Most of the artificial sweeteners are inert and do not metabolise in the body.

Q 25.

What are enzyme inhibitors? Classify them on the basis of their mode of attachments on the active site of enzymes. With the help of diagrams explain how do inhibitors inhibit the enzymatic activity.
Ckemistnj in Evenjdai] Life 325

Q 26.

What are the main constituents of dettol?

Q 27.

Which of the following are anionic detergents?
(a) Sodium salts of sulphonated long chain alcohol.
(b) Ester of stearic acid and polyethylene glycol.
(c) Quaternary ammonium salt of amine with acetate ion.
(d) Sodium salts of sulphonated long chain hydrocarbons.

Q 28.

Which type of drugs come under antimicrobial drugs?

Q 29.

What type of forces are involved in binding of substrate to the active site of enzyme?

Q 30.

Hair shampoos belong to which class of synthetic detergent?

Q 31.

Name an artificial sweetener which is derivative of sucrose.

Q 32.

Match the soaps given in Column I with items given in Column II.
ncert-exemplar-problems-class-12-chemistry-chemistry-everyday-life-10

Q 33.

In what respect do prontosil and Salvarsan resemble? Is there any resemblance between azo dye and prontosil? Explain.

Q 34.

With refrence to which classification has the statement "ranitidine is an antacid", been given?

Q 35.

Why do we require artificial sweetening agents?

Q 36.

Name the macro molecules that are chosen as drug targets.

Q 37.

What are artificial sweetening agents? Give two examples.

Q 38.

Name the sweetening agent used in the preparation of sweets for a diabetic patient.

Q 39.

Explain the cleansing action of soaps.

Q 40.

Which of the following are sulpha drugs?
(a) Sulphapyridine (b) Prontosil
(c) Salvarsan (d) Nardil

Q 41.

What is the mode of action of antimicrobial drugs?

Q 42.

What is the side product of soap industry? Give reactions showing soap formation.

Q 43.

Why are certain drugs called enzyme inhibitors?

Q 44.

Write the chemical equation for preparing sodium soap from glyceryl oleate and glyceryl palmitate. Structures of these compounds are given below:
(i)(C15H31COO)3C3H5-Glyceryl palmitate
(ii)(C17H32COO)3C3H5-Glyceryl oleate

Q 45.

Why should not medicines be taken without consulting doctors?

Q 46.

Define the term chemotherapy.

Q 47.

Low level of noradrenaline is the cause of depression. What type of drugs are needed to cure this problem? Name two drugs.

Q 48.

How are synthetic detergents better than soaps?

Q 49.

Which of the following compounds are administered as ant-acids?
(a) Sodium carbonate (b)Sodium Hydrogen carbonate
(c)Aluminium carbonate (d)Magnism Hydroxide

Q 50.

What is the harmful effect of hyperacidity?