Chemistry

Chemistry in Everyday Life

Question:

Synthetic detergents have advantage over usual soaps as far as cleansing power is concerned. But use of synthetic detergents over a long time creates environmental pollution. How can the pollution caused by synthetic detergents be minimized? Classify the detergents according to their chemical nature.

Answer:

Synthetic detergents are cleansing agents which have all the properties of soaps, but which actually do not contain any soap. These can be used both in soft and hard water as they given foam even in hard water. Detergents can be classified into three groups according their chemical nature.
(i) Anionic detergents – These are sodium salts of sulphonated long chain alcohols or hydrocarbons and sodium alkyl benzene sulphonates. e.g., CH3(CH2)10CH2OSO3–  Na+
Anionic part of these detergents is involved in cleansing action.
(ii) Cationic detergents – These are quaternary ammonium salts of amines with acetates, chlorides or bromides as anions.
ncert-exemplar-problems-class-12-chemistry-chemistry-everyday-life-21
(iii) Non-ionic detergents – These do not contain any ion in their constitution, e.g., detergent formed by steric acid and polyethylene glycol. CH3(CH2)16C00(CH2CH20)nCH2CH2OH.
Pollution by synthetic detergents can be minimized by reducing the branching of hydrocarbon chain or using unbranched hydrocarbons.

previuos
next

Chemistry in Everyday Life

Q 1.

What is the basic difference between antiseptics and disinfectants?

Q 2.

Which of the following are anionic detergents?
(a) Sodium salts of sulphonated long chain alcohol.
(b) Ester of stearic acid and polyethylene glycol.
(c) Quaternary ammonium salt of amine with acetate ion.
(d) Sodium salts of sulphonated long chain hydrocarbons.

Q 3.

Which class of drugs is used in sleeping pills?

Q 4.

How are transparent soaps manufactured?

Q 5.

What is a soft soap?

Q 6.

How are receptor proteins located in the cell membrane?

Q 7.

While antacids and antiallergic drugs interfere with the function of histamines, why do these not interfere with the function of each other?

Q 8.

What is the harmful effect of hyperacidity?

Q 9.

What type of forces are involved in binding of substrate to the active site of enzyme?

Q 10.

What is the scientific explanation for the feeling of depression?

Q 11.

In the following questions, a statement of Assertion (A) followed by a statement of Reason (R) is given. Choose the correct answer out of the following choices:
(a) Assertion and reason both are correct statements but reason does not explain assertion.
(b) Assertion and reason-both are correct statements and reason explains the assertion.
(c) Both assertion and reason are wrong statement.
(d) Assertion is correct statement and reason is wrong statements.
(e) Assertion is wrong statements and reason is correct statement.

Assertion (A): Penicillin (G) is an antihistamine.
Reason (R): Penicillin (G) is effective against gram positive as well as gram negative bacteria. .

Q 12.

If soap has high alkali content it’irritates skin. How can the amount of excess alkali be determined? What can be the source of excess alkali?

Q 13.

Assertion (A): Non-competitive inhibitor inhibits the catalytic activity of enzyme by binding with its active site.
Reason (R): Non-competitive inhibitors changes the shape of the active site in such a way that substrate cannot recognize it.

Q 14.

Why are cimetidine and ranitidine better antacids than sodium hydrogencarbonate or magnesium or aluminium hydroxide?

Q 15.

What is the medicinal use of narcotic drugs?

Q 16.

What are fillers and what role these fillers play in soap?

Q 17.

Assertion (A): Receptor proteins show selectivity for one chemical messenger over the other.
Reason (R): Chemical messenger binds to the receptor site and inhibits its natural function.

Q 18.

Assertion (A): All chemicals added to food items are called food preservatives.
Reason (R): All these chemicals increase the nutritive value of the food.

Q 19.

Why do we need to classify drugs in different ways?

Q 20.

Name the macro molecules that are chosen as drug targets.

Q 21.

What are biodegradable and non-biodegradable detergents? Give one example of each.

Q 22.

Compounds with antiseptic properties are
(a) CHCl,   (b) CHI3
(c) Boric acid   (d) 0.3 ppm aqueous solution of Cl2

Q 23.

Both antacids and antiallergic drugs are antihistamines but they cannot replace each other. Explain why?

Q 24.

What happens when the bond formed between an enzyme and an inhibitor is a strong covalent bond?

Q 25.

How do enzymes catalyse a chemical reaction in the living system? Explain drug target interaction taking the example of enzyme as target.

Q 26.

With refrence to which classification has the statement "ranitidine is an antacid", been given?

Q 27.

How are synthetic detergents better than soaps?

Q 28.

Which of the following is an example of liquid dishwashing detergent?
ncert-exemplar-problems-class-12-chemistry-chemistry-everyday-life-1

Q 29.

Dishwashing soaps are synthetic detergents. What is their chemical nature?

Q 30.

Between sodium hydrogen carbonate and magnesium hydroxide which is a better antacid and why?

Q 31.

What is the mode of action of antimicrobial drugs?

Q 32.

What are the functions performed by histamine in the body?

Q 33.

What is the difference between saccharin and saccharic acid?

Q 34.

Name two ct-amino acids which form a dipeptide which is 100 times more sweet than cane sugar?

Q 35.

Match the soaps given in Column I with items given in Column II.
ncert-exemplar-problems-class-12-chemistry-chemistry-everyday-life-10

Q 36.

What are enzyme inhibitors? Classify them on the basis of their mode of attachments on the active site of enzymes. With the help of diagrams explain how do inhibitors inhibit the enzymatic activity.
Ckemistnj in Evenjdai] Life 325

Q 37.

Why do we require artificial sweetening agents?

Q 38.

Why do soaps not work in hard water?

Q 39.

Which of the following are not used as food preservatives?
(a) Table salt (b) Sodium hydrogen carbonate
(c) Cane sugar (d) Benzoic acid

Q 40.

Aspirin is pain relieving antipyretic drug but can be used to prevent heart attack. Explain.

Q 41.

Draw the diagram showing micelle formation by the following detergent. CH3(CH2)10CH2O SO3  Na+.

Q 42.

What is the medicinal use of narcotic drugs?

Q 43.

Name an artificial sweetener which is derivative of sucrose.

Q 44.

Assertion (A): Chemical messengers are chemicals that enable communi ¬cation of message between two neutrons or between neurons and muscles. Reason (R): Chemicals enter the cell through receptor.

Q 45.

Assertion (A): Preservative are added to food items.
Reason (R): Preservatives inhibit the growth of microorganisms.

Q 46.

Sleeping pills are recommended by doctors to the patients suffering from sleeplessness but it is not advisable to take its doses without consultation with the doctor. Why?

Q 47.

Explain the term, target molecules or drug targets as used in medicinal chemistry.

Q 48.

What is meant by the term broad spectrum antibiotics? Explain.

Q 49.

How do antiseptics differ from disinfectants? Give one example of each.

Q 50.

What are the main constituents of dettol?