Biology

Natural Resources

Question:

What is meant by depletion of ozone layer? Mention one important feature of ozone in atmosphere. Identify the factors responsible for the formation of ozone hole.

Answer:

The part of atmosphere, at height 320 km above sea level, there is a 5km thick ozone layer. This layer acts as a shield/blanket which absorbs UV radiations from sunlight. Thus it saves biotic life on the earth from the harmful effects UV radiation. Over Antarctica, there is declining of ozone layer thickness and hole is seen. If depletion of ozone layer dwindles further, it would have severe consequences on the lives of living beings. Following are the main chemicals responsible for the destruction of ozone layer: 1. chlorofluorocarbons(CFCs)
2. halogens (used in fire extinguishers)
3. methane and nitrous oxide
CFCs used as propellants in aeroplanes and coolant in refrigeration are the most damaging, which catalytically destroy ozone and convert it into oxygen.
previuos
next

Natural Resources

Q 1.

Fill In the Blanks :
The life-supporting zone of the Earth where the atmosphere, the hydrosphere and the lithosphere interact and make life possible, is known as the ____________.

Q 2.

What is lithosphere?

Q 3.

Name two diseases caused due to an increased content of pollutants in the air produced due to the burning of fossil fuels.

Q 4.

Fill In the Blanks :
The eggs and larvae of various aquatic animals are particularly susceptible to _____________ changes.

Q 5.

How does the atmosphere act as a blanket?

Q 6.

How do fossil fuel cause air pollution?

Q 7.

What is hydrosphere?

Q 8.

Fill In the Blanks :
The life-supporting zone of the Earth where the atmosphere, hydrosphere and lithosphere interact and make life possible. ________

Q 9.

Fill In the Blanks :
An increase in the content of these harmful substances in air is called ________ ?

Q 10.

Fill In the Blanks :
Control of water and electrolyte balance in the body. ________

Q 11.

Fill In the Blanks :
The cyclic transformation of chemicals through interacting biological, geological and chemical processes that causes transfer of energy and matter amid the various components of the biosphere, leading to a balance between them. ________

Q 12.

List any three human activities that you think would lead to air pollution.

Q 13.

Water is known as "A Wonder Liquid". Justify this statement by giving any two reasons.

Q 14.

Fill In the Blanks :
The fossil fuels like coal and petroleum contain small amounts of __________ and __________ which are primarily responsible for acid rain.

Q 15.

What is atmosphere?

Q 16.

Fill In the Blanks :
The living components of the environment. ________

Q 17.

What is meant by depletion of ozone layer? Mention one important feature of ozone in atmosphere. Identify the factors responsible for the formation of ozone hole.

Q 18.

Fill In the Blanks :
The region which includes all the earth's liquid water, frozen water and small amounts of water vapor in the earth's atmosphere. ________

Q 19.

Fill In the Blanks :
Hot air is ___________ than cold air.

Q 20.

Fill In the Blanks :
Dead remains of plants and animals is called __________.

Q 21.

Fill In the Blanks :
On planets like Venus and Mars the major component of the atmosphere is ___________.

Q 22.

In which regions is soil erosion very difficult to revert?

Q 23.

Fill In the Blanks :
The mass of air surrounding the Earth. ________

Q 24.

Fill In the Blanks :
The space among the soil particles are filled with ________.

Q 25.

Which gets heated faster land or water?

Q 26.

Fill In the Blanks :
_________ is the region of atmosphere where ozone layer is present.

Q 27.

Define air-pollution?

Q 28.

What are the effects of acid rain?

Q 29.

List the four zones of the atmosphere.

Q 30.

Why do organisms need water?

Q 31.

Fill In the Blanks :
In the upper layer of the atmosphere, a molecule containing three atoms of oxygen is found. It is called ________.

Q 32.

What is smog?

Q 33.

Fill In the Blanks :
The non-living components of the environment. ________

Q 34.

Fill In the Blanks :
________ is formed due to condensation of water vapours in the lower region of atmosphere.

Q 35.

Why is water essential for life?

Q 36.

How is our atmosphere different from the atmosphere on Venus and Mars?

Q 37.

Fill In the Blanks :
Soil contains bits of decayed living organisms which is called ________ ?

Q 38.

Fill In the Blanks :
A process in which anaerobic bacteria convert nitrate ions into nitrogen gas. ________

Q 39.

What are biogeochemic cycles? Names two examples.

Q 40.

Fill In the Blanks :
__________ is a major factor in deciding the soil structure because it causes the soil to become more porous and allows water and air to penetrate deep underground.

Q 41.

Fill In the Blanks :
Green plants convert carbon dioxide into glucose in the presence of ______________.

Q 42.

What causes winds?

Q 43.

Fill In the Blanks :
The outer crust of the Earth. ________

Q 44.

Give an example of fungi which are known as 'indicator of air pollution'.

Q 45.

Fill In the Blanks :
The substances that cause pollution are called ___________.

Q 46.

Fill In the Blanks :
An increase in the percentage of such gases in the atmosphere would cause the average temperatures to increase world-wide and this is called ________?

Q 47.

Fill In the Blanks :
Specific Organisms  are found to be very sensitive to the levels of contaminants like sulphur dioxide in the air. What are these organisms called ________?

Q 48.

Fill In the Blanks :
Ozone hole was first detected over ____________.

Q 49.

Meenakshi saw reduction in greenish layer of lichens at the bark of trees at the biology garden of the school. The garden was few metres away from diesel generator placed for electricity backup. She immediately informed the school authorities to check the pollution level of diesel and kerosene used in the generator.
(a) How reduction in Lichens layer is related to pollution?
(b) What measures should be taken by school authorities to check the reduction?
(c) What qualities are shown by Meenakshi by informing school about the Lichens?

Q 50.

How are clouds formed?