Question:
What is meant by depletion of ozone layer? Mention one important feature of ozone in atmosphere. Identify the factors responsible for the formation of ozone hole.
Answer:
The part of atmosphere, at height 320 km above sea level, there is a 5km thick ozone layer. This layer acts as a shield/blanket which absorbs UV radiations from sunlight. Thus it saves biotic life on the earth from the harmful effects UV radiation. Over Antarctica, there is declining of ozone layer thickness and hole is seen. If depletion of ozone layer dwindles further, it would have severe consequences on the lives of living beings. Following are the main chemicals responsible for the destruction of ozone layer: 1. chlorofluorocarbons(CFCs)
2. halogens (used in fire extinguishers)
3. methane and nitrous oxide
CFCs used as propellants in aeroplanes and coolant in refrigeration are the most damaging, which catalytically destroy ozone and convert it into oxygen.
Natural Resources
Q 1.
What is lithosphere?
Q 2.
Fill In the Blanks :
The life-supporting zone of the Earth where the atmosphere, the hydrosphere and the lithosphere interact and make life possible, is known as the ____________.
Q 3.
Water is known as "A Wonder Liquid". Justify this statement by giving any two reasons.
Q 4.
Fill In the Blanks :
The fossil fuels like coal and petroleum contain small amounts of __________ and __________ which are primarily responsible for acid rain.
Q 5.
Define air-pollution?
Q 6.
Name two diseases caused due to an increased content of pollutants in the air produced due to the burning of fossil fuels.
Q 8.
In which regions is soil erosion very difficult to revert?
Q 9.
Fill In the Blanks :
The eggs and larvae of various aquatic animals are particularly susceptible to _____________ changes.
Q 10.
Fill In the Blanks :
The cyclic transformation of chemicals through interacting biological, geological and chemical processes that causes transfer of energy and matter amid the various components of the biosphere, leading to a balance between them. ________
Q 11.
How do fossil fuel cause air pollution?
Q 12.
Which gets heated faster land or water?
Q 13.
Fill In the Blanks :
The mass of air surrounding the Earth. ________
Q 14.
Fill In the Blanks :
On planets like Venus and Mars the major component of the atmosphere is ___________.
Q 15.
Fill In the Blanks :
Control of water and electrolyte balance in the body. ________
Q 16.
Fill In the Blanks :
The living components of the environment. ________
Q 17.
How does the atmosphere act as a blanket?
Q 18.
Fill In the Blanks :
An increase in the content of these harmful substances in air is called ________ ?
Q 19.
Why do organisms need water?
Q 20.
What is hydrosphere?
Q 21.
What is meant by depletion of ozone layer? Mention one important feature of ozone in atmosphere. Identify the factors responsible for the formation of ozone hole.
Q 22.
List any three human activities that you think would lead to air pollution.
Q 23.
Fill In the Blanks :
Dead remains of plants and animals is called __________.
Q 24.
Fill In the Blanks :
The region which includes all the earth's liquid water, frozen water and small amounts of water vapor in the earth's atmosphere. ________
Q 26.
Fill In the Blanks :
The space among the soil particles are filled with ________.
Q 27.
Fill In the Blanks :
_________ is the region of atmosphere where ozone layer is present.
Q 28.
What are the effects of acid rain?
Q 29.
Fill In the Blanks :
The non-living components of the environment. ________
Q 30.
Fill In the Blanks :
In the upper layer of the atmosphere, a molecule containing three atoms of oxygen is found. It is called ________.
Q 31.
Fill In the Blanks :
________ is formed due to condensation of water vapours in the lower region of atmosphere.
Q 32.
How is our atmosphere different from the atmosphere on Venus and Mars?
Q 33.
Fill In the Blanks :
The life-supporting zone of the Earth where the atmosphere, hydrosphere and lithosphere interact and make life possible. ________
Q 34.
Fill In the Blanks :
Soil contains bits of decayed living organisms which is called ________ ?
Q 35.
Fill In the Blanks :
The outer crust of the Earth. ________
Q 37.
Fill In the Blanks :
A process in which anaerobic bacteria convert nitrate ions into nitrogen gas. ________
Q 38.
Why is water essential for life?
Q 39.
Fill In the Blanks :
Hot air is ___________ than cold air.
Q 40.
Fill In the Blanks :
Green plants convert carbon dioxide into glucose in the presence of ______________.
Q 41.
What are biogeochemic cycles? Names two examples.
Q 42.
Fill In the Blanks :
__________ is a major factor in deciding the soil structure because it causes the soil to become more porous and allows water and air to penetrate deep underground.
Q 43.
Fill In the Blanks :
Specific Organisms are found to be very sensitive to the levels of contaminants like sulphur dioxide in the air. What are these organisms called ________?
Q 44.
How are clouds formed?
Q 45.
Give an example of fungi which are known as 'indicator of air pollution'.
Q 46.
Fill In the Blanks :
Water covers _____% of the Earth's surface.
Q 47.
Meenakshi saw reduction in greenish layer of lichens at the bark of trees at the biology garden of the school. The garden was few metres away from diesel generator placed for electricity backup. She immediately informed the school authorities to check the pollution level of diesel and kerosene used in the generator.
(a) How reduction in Lichens layer is related to pollution?
(b) What measures should be taken by school authorities to check the reduction?
(c) What qualities are shown by Meenakshi by informing school about the Lichens?
Q 48.
Fill In the Blanks :
An increase in the average temperature of the earth's atmosphere, brought about by the enhanced greenhouse effect. ________
Q 49.
Fill In the Blanks :
Ozone hole was first detected over ____________.
Q 50.
Fill In the Blanks :
An increase in the percentage of such gases in the atmosphere would cause the average temperatures to increase world-wide and this is called ________?